C10H7F8NO — CID 171236922
(1R,3S)-3-amino-4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol (PubChem CID 171236922) has the molecular formula C10H7F8NO and a molecular weight of 309.16 g/mol. Its IUPAC name is (1R,3S)-3-amino-4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol.
| Compound Name | (1R,3S)-3-amino-4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol |
|---|---|
| PubChem CID | 171236922 |
| Molecular Formula | C10H7F8NO |
| Molecular Weight | 309.16 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | (1R,3S)-3-amino-4,4,4-trifluoro-1-(2,3,4,5,6-pentafluorophenyl)butan-1-ol |
| SMILES | N[C@@H](C[C@@H](O)c1c(F)c(F)c(F)c(F)c1F)C(F)(F)F |
| InChI | InChI=1S/C10H7F8NO/c11-5-4(2(20)1-3(19)10(16,17)18)6(12)8(14)9(15)7(5)13/h2-3,20H,1,19H2/t2-,3+/m1/s1 |
| InChIKey | QDLMIRNCCRKYPS-GBXIJSLDSA-N |
| XLogP | 2.70 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.16 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|