C13H17ClF5NO — CID 171237075
(1S,3S)-3-amino-4,4-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol;hydrochloride (PubChem CID 171237075) has the molecular formula C13H17ClF5NO and a molecular weight of 333.73 g/mol. Its IUPAC name is (1S,3S)-3-amino-4,4-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol;hydrochloride.
| Compound Name | (1S,3S)-3-amino-4,4-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol;hydrochloride |
|---|---|
| PubChem CID | 171237075 |
| Molecular Formula | C13H17ClF5NO |
| Molecular Weight | 333.73 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | (1S,3S)-3-amino-4,4-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pentan-1-ol;hydrochloride |
| SMILES | CC(C)(C)[C@@H](N)C[C@H](O)c1c(F)c(F)c(F)c(F)c1F.Cl |
| InChI | InChI=1S/C13H16F5NO.ClH/c1-13(2,3)6(19)4-5(20)7-8(14)10(16)12(18)11(17)9(7)15;/h5-6,20H,4,19H2,1-3H3;1H/t5-,6-;/m0./s1 |
| InChIKey | JQYKOHPHHLIJDK-GEMLJDPKSA-N |
| XLogP | 3.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.73 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|