C13H19F2NO — CID 171236754
(1R,3S)-3-amino-1-(2,6-difluorophenyl)-4,4-dimethylpentan-1-ol (PubChem CID 171236754) has the molecular formula C13H19F2NO and a molecular weight of 243.30 g/mol. Its IUPAC name is (1R,3S)-3-amino-1-(2,6-difluorophenyl)-4,4-dimethylpentan-1-ol.
| Compound Name | (1R,3S)-3-amino-1-(2,6-difluorophenyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 171236754 |
| Molecular Formula | C13H19F2NO |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.14 |
| IUPAC Name | (1R,3S)-3-amino-1-(2,6-difluorophenyl)-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(C)[C@@H](N)C[C@@H](O)c1c(F)cccc1F |
| InChI | InChI=1S/C13H19F2NO/c1-13(2,3)11(16)7-10(17)12-8(14)5-4-6-9(12)15/h4-6,10-11,17H,7,16H2,1-3H3/t10-,11+/m1/s1 |
| InChIKey | RWIQWWYPMRVWED-MNOVXSKESA-N |
| XLogP | 2.76 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |