C12H14F5NO — CID 171161912
(1S,2R)-1-amino-3,3-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)butan-2-ol (PubChem CID 171161912) has the molecular formula C12H14F5NO and a molecular weight of 283.24 g/mol. Its IUPAC name is (1S,2R)-1-amino-3,3-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-3,3-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 171161912 |
| Molecular Formula | C12H14F5NO |
| Molecular Weight | 283.24 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | (1S,2R)-1-amino-3,3-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)butan-2-ol |
| SMILES | CC(C)(C)[C@@H](O)[C@@H](N)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H14F5NO/c1-12(2,3)11(19)10(18)4-5(13)7(15)9(17)8(16)6(4)14/h10-11,19H,18H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | KIYBUMBCWFZIFO-QWRGUYRKSA-N |
| XLogP | 2.79 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.24 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|