C12H16F3NO — CID 171161596
(1S,2R)-1-amino-3,3-dimethyl-1-(2,4,5-trifluorophenyl)butan-2-ol (PubChem CID 171161596) has the molecular formula C12H16F3NO and a molecular weight of 247.26 g/mol. Its IUPAC name is (1S,2R)-1-amino-3,3-dimethyl-1-(2,4,5-trifluorophenyl)butan-2-ol.
| Compound Name | (1S,2R)-1-amino-3,3-dimethyl-1-(2,4,5-trifluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 171161596 |
| Molecular Formula | C12H16F3NO |
| Molecular Weight | 247.26 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (1S,2R)-1-amino-3,3-dimethyl-1-(2,4,5-trifluorophenyl)butan-2-ol |
| SMILES | CC(C)(C)[C@@H](O)[C@@H](N)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H16F3NO/c1-12(2,3)11(17)10(16)6-4-8(14)9(15)5-7(6)13/h4-5,10-11,17H,16H2,1-3H3/t10-,11-/m0/s1 |
| InChIKey | HGADWAJQBHTIPL-QWRGUYRKSA-N |
| XLogP | 2.51 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|