C9H10F3NO — CID 130641514
(1R,2S)-1-amino-1-(2,4,5-trifluorophenyl)propan-2-ol (PubChem CID 130641514) has the molecular formula C9H10F3NO and a molecular weight of 205.18 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2,4,5-trifluorophenyl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2,4,5-trifluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 130641514 |
| Molecular Formula | C9H10F3NO |
| Molecular Weight | 205.18 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | (1R,2S)-1-amino-1-(2,4,5-trifluorophenyl)propan-2-ol |
| SMILES | C[C@H](O)[C@H](N)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C9H10F3NO/c1-4(14)9(13)5-2-7(11)8(12)3-6(5)10/h2-4,9,14H,13H2,1H3/t4-,9-/m0/s1 |
| InChIKey | SEODHBUZCHCMQO-IGJIYHIXSA-N |
| XLogP | 1.48 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.18 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|