C8H9Cl2FN2O — CID 131190586
(1R,2S)-1-amino-1-(2,6-dichloro-5-fluoro-3-pyridinyl)propan-2-ol (PubChem CID 131190586) has the molecular formula C8H9Cl2FN2O and a molecular weight of 239.08 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2,6-dichloro-5-fluoro-3-pyridinyl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2,6-dichloro-5-fluoro-3-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 131190586 |
| Molecular Formula | C8H9Cl2FN2O |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | (1R,2S)-1-amino-1-(2,6-dichloro-5-fluoro-3-pyridinyl)propan-2-ol |
| SMILES | C[C@H](O)[C@H](N)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C8H9Cl2FN2O/c1-3(14)6(12)4-2-5(11)8(10)13-7(4)9/h2-3,6,14H,12H2,1H3/t3-,6-/m0/s1 |
| InChIKey | CZKSJPBHGJFACF-DZSWIPIPSA-N |
| XLogP | 1.91 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|