C8H10F2N2O — CID 55272818
(1R,2S)-1-amino-1-(3,5-difluoro-4-pyridinyl)propan-2-ol (PubChem CID 55272818) has the molecular formula C8H10F2N2O and a molecular weight of 188.18 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(3,5-difluoro-4-pyridinyl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(3,5-difluoro-4-pyridinyl)propan-2-ol |
|---|---|
| PubChem CID | 55272818 |
| Molecular Formula | C8H10F2N2O |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | (1R,2S)-1-amino-1-(3,5-difluoro-4-pyridinyl)propan-2-ol |
| SMILES | C[C@H](O)[C@H](N)c1c(F)cncc1F |
| InChI | InChI=1S/C8H10F2N2O/c1-4(13)8(11)7-5(9)2-12-3-6(7)10/h2-4,8,13H,11H2,1H3/t4-,8-/m0/s1 |
| InChIKey | ZLYNVNCTNJZMQO-NVNXEXLPSA-N |
| XLogP | 0.74 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |