C9H9F4NO — CID 131565436
(1R,2S)-1-amino-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol (PubChem CID 131565436) has the molecular formula C9H9F4NO and a molecular weight of 223.17 g/mol. Its IUPAC name is (1R,2S)-1-amino-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol.
| Compound Name | (1R,2S)-1-amino-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol |
|---|---|
| PubChem CID | 131565436 |
| Molecular Formula | C9H9F4NO |
| Molecular Weight | 223.17 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | (1R,2S)-1-amino-1-(2,3,5,6-tetrafluorophenyl)propan-2-ol |
| SMILES | C[C@H](O)[C@H](N)c1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C9H9F4NO/c1-3(15)9(14)6-7(12)4(10)2-5(11)8(6)13/h2-3,9,15H,14H2,1H3/t3-,9-/m0/s1 |
| InChIKey | PYDUIKWCRCNIFJ-KTCWOMIQSA-N |
| XLogP | 1.62 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.17 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|