C11H14ClF4N — CID 171230095
(1S)-2-methyl-1-(2,3,5,6-tetrafluorophenyl)butan-1-amine;hydrochloride (PubChem CID 171230095) has the molecular formula C11H14ClF4N and a molecular weight of 271.69 g/mol. Its IUPAC name is (1S)-2-methyl-1-(2,3,5,6-tetrafluorophenyl)butan-1-amine;hydrochloride.
| Compound Name | (1S)-2-methyl-1-(2,3,5,6-tetrafluorophenyl)butan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171230095 |
| Molecular Formula | C11H14ClF4N |
| Molecular Weight | 271.69 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (1S)-2-methyl-1-(2,3,5,6-tetrafluorophenyl)butan-1-amine;hydrochloride |
| SMILES | CCC(C)[C@H](N)c1c(F)c(F)cc(F)c1F.Cl |
| InChI | InChI=1S/C11H13F4N.ClH/c1-3-5(2)11(16)8-9(14)6(12)4-7(13)10(8)15;/h4-5,11H,3,16H2,1-2H3;1H/t5?,11-;/m0./s1 |
| InChIKey | LIZPELASSQFVCO-SNFZQOFZSA-N |
| XLogP | 3.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.69 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|