C12H19ClFN — CID 171204039
(1R)-1-(2-fluoro-5-methylphenyl)-2-methylbutan-1-amine;hydrochloride (PubChem CID 171204039) has the molecular formula C12H19ClFN and a molecular weight of 231.74 g/mol. Its IUPAC name is (1R)-1-(2-fluoro-5-methylphenyl)-2-methylbutan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(2-fluoro-5-methylphenyl)-2-methylbutan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171204039 |
| Molecular Formula | C12H19ClFN |
| Molecular Weight | 231.74 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | (1R)-1-(2-fluoro-5-methylphenyl)-2-methylbutan-1-amine;hydrochloride |
| SMILES | CCC(C)[C@@H](N)c1cc(C)ccc1F.Cl |
| InChI | InChI=1S/C12H18FN.ClH/c1-4-9(3)12(14)10-7-8(2)5-6-11(10)13;/h5-7,9,12H,4,14H2,1-3H3;1H/t9?,12-;/m1./s1 |
| InChIKey | BZVAPXYANROTJD-ZHWMGRLRSA-N |
| XLogP | 3.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.74 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |