C13H20FNO2 — CID 171214001
(1R)-1-(2-fluoro-4,5-dimethoxyphenyl)-2-methylbutan-1-amine (PubChem CID 171214001) has the molecular formula C13H20FNO2 and a molecular weight of 241.31 g/mol. Its IUPAC name is (1R)-1-(2-fluoro-4,5-dimethoxyphenyl)-2-methylbutan-1-amine.
| Compound Name | (1R)-1-(2-fluoro-4,5-dimethoxyphenyl)-2-methylbutan-1-amine |
|---|---|
| PubChem CID | 171214001 |
| Molecular Formula | C13H20FNO2 |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (1R)-1-(2-fluoro-4,5-dimethoxyphenyl)-2-methylbutan-1-amine |
| SMILES | CCC(C)[C@@H](N)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C13H20FNO2/c1-5-8(2)13(15)9-6-11(16-3)12(17-4)7-10(9)14/h6-8,13H,5,15H2,1-4H3/t8?,13-/m1/s1 |
| InChIKey | HYYAQHIKSMGPHM-AZMWARKLSA-N |
| XLogP | 2.89 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |