C14H22FNO2 — CID 62867105
2-ethyl-1-(2-fluoro-4,5-dimethoxyphenyl)butan-1-amine (PubChem CID 62867105) has the molecular formula C14H22FNO2 and a molecular weight of 255.33 g/mol. Its IUPAC name is 2-ethyl-1-(2-fluoro-4,5-dimethoxyphenyl)butan-1-amine.
| Compound Name | 2-ethyl-1-(2-fluoro-4,5-dimethoxyphenyl)butan-1-amine |
|---|---|
| PubChem CID | 62867105 |
| Molecular Formula | C14H22FNO2 |
| Molecular Weight | 255.33 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 2-ethyl-1-(2-fluoro-4,5-dimethoxyphenyl)butan-1-amine |
| SMILES | CCC(CC)C(N)c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C14H22FNO2/c1-5-9(6-2)14(16)10-7-12(17-3)13(18-4)8-11(10)15/h7-9,14H,5-6,16H2,1-4H3 |
| InChIKey | LADCYDVOQQJMFG-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.33 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |