C8H8F2O2 — CID 853175
1,2-difluoro-4,5-dimethoxybenzene (PubChem CID 853175) has the molecular formula C8H8F2O2 and a molecular weight of 174.15 g/mol. Its IUPAC name is 1,2-difluoro-4,5-dimethoxybenzene.
| Compound Name | 1,2-difluoro-4,5-dimethoxybenzene |
|---|---|
| PubChem CID | 853175 |
| Molecular Formula | C8H8F2O2 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.05 |
| IUPAC Name | 1,2-difluoro-4,5-dimethoxybenzene |
| SMILES | COc1cc(F)c(F)cc1OC |
| InChI | InChI=1S/C8H8F2O2/c1-11-7-3-5(9)6(10)4-8(7)12-2/h3-4H,1-2H3 |
| InChIKey | WWAOVLXLTJXDGS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |