C10H12FNO3 — CID 91937675
(E)-1-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxymethanimine (PubChem CID 91937675) has the molecular formula C10H12FNO3 and a molecular weight of 213.21 g/mol. Its IUPAC name is (E)-1-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxymethanimine.
| Compound Name | (E)-1-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxymethanimine |
|---|---|
| PubChem CID | 91937675 |
| Molecular Formula | C10H12FNO3 |
| Molecular Weight | 213.21 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | (E)-1-(2-fluoro-4,5-dimethoxyphenyl)-N-methoxymethanimine |
| SMILES | CO/N=C/c1cc(OC)c(OC)cc1F |
| InChI | InChI=1S/C10H12FNO3/c1-13-9-4-7(6-12-15-3)8(11)5-10(9)14-2/h4-6H,1-3H3/b12-6+ |
| InChIKey | PSAAFQNKRYQTRV-WUXMJOGZSA-N |
| XLogP | 1.82 |
| TPSA | 40.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.21 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|