C11H11FO4 — CID 53403843
3-(2-fluoro-4,5-dimethoxyphenyl)prop-2-enoic acid (PubChem CID 53403843) has the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. Its IUPAC name is 3-(2-fluoro-4,5-dimethoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(2-fluoro-4,5-dimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 53403843 |
| Molecular Formula | C11H11FO4 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 3-(2-fluoro-4,5-dimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(F)c(C=CC(=O)O)cc1OC |
| InChI | InChI=1S/C11H11FO4/c1-15-9-5-7(3-4-11(13)14)8(12)6-10(9)16-2/h3-6H,1-2H3,(H,13,14) |
| InChIKey | AIJRYLNBFGKWES-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|