C10H9O5- — CID 90657637
2-[(Z)-2-carboxyethenyl]-5-hydroxy-4-methoxyphenolate (PubChem CID 90657637) has the molecular formula C10H9O5- and a molecular weight of 209.18 g/mol. Its IUPAC name is 2-[(Z)-2-carboxyethenyl]-5-hydroxy-4-methoxyphenolate.
| Compound Name | 2-[(Z)-2-carboxyethenyl]-5-hydroxy-4-methoxyphenolate |
|---|---|
| PubChem CID | 90657637 |
| Molecular Formula | C10H9O5- |
| Molecular Weight | 209.18 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 2-[(Z)-2-carboxyethenyl]-5-hydroxy-4-methoxyphenolate |
| SMILES | COc1cc(/C=C\C(=O)O)c([O-])cc1O |
| InChI | InChI=1S/C10H10O5/c1-15-9-4-6(2-3-10(13)14)7(11)5-8(9)12/h2-5,11-12H,1H3,(H,13,14)/p-1/b3-2- |
| InChIKey | QVTORZSLDIMFQS-IHWYPQMZSA-M |
| XLogP | 0.57 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.18 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|