C15H19O5- — CID 140642224
2-[(Z)-2-carboxyethenyl]-4-[(1S)-1-hydroxy-3-methylbutyl]-5-methoxyphenolate (PubChem CID 140642224) has the molecular formula C15H19O5- and a molecular weight of 279.31 g/mol. Its IUPAC name is 2-[(Z)-2-carboxyethenyl]-4-[(1S)-1-hydroxy-3-methylbutyl]-5-methoxyphenolate.
| Compound Name | 2-[(Z)-2-carboxyethenyl]-4-[(1S)-1-hydroxy-3-methylbutyl]-5-methoxyphenolate |
|---|---|
| PubChem CID | 140642224 |
| Molecular Formula | C15H19O5- |
| Molecular Weight | 279.31 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 2-[(Z)-2-carboxyethenyl]-4-[(1S)-1-hydroxy-3-methylbutyl]-5-methoxyphenolate |
| SMILES | COc1cc([O-])c(/C=C\C(=O)O)cc1[C@@H](O)CC(C)C |
| InChI | InChI=1S/C15H20O5/c1-9(2)6-13(17)11-7-10(4-5-15(18)19)12(16)8-14(11)20-3/h4-5,7-9,13,16-17H,6H2,1-3H3,(H,18,19)/p-1/b5-4-/t13-/m0/s1 |
| InChIKey | KXEZMFMTEVLUPQ-ZFDPJTLLSA-M |
| XLogP | 1.95 |
| TPSA | 89.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|