C17H24O2 — CID 70015103
3-[4-ethyl-2,5-di(propan-2-yl)phenyl]prop-2-enoic acid (PubChem CID 70015103) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is 3-[4-ethyl-2,5-di(propan-2-yl)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-ethyl-2,5-di(propan-2-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 70015103 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | 3-[4-ethyl-2,5-di(propan-2-yl)phenyl]prop-2-enoic acid |
| SMILES | CCc1cc(C(C)C)c(C=CC(=O)O)cc1C(C)C |
| InChI | InChI=1S/C17H24O2/c1-6-13-9-16(12(4)5)14(7-8-17(18)19)10-15(13)11(2)3/h7-12H,6H2,1-5H3,(H,18,19) |
| InChIKey | KNSMBEOYVJIORX-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|