C10H8Br2O4 — CID 57362942
3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid (PubChem CID 57362942) has the molecular formula C10H8Br2O4 and a molecular weight of 351.98 g/mol. Its IUPAC name is 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid.
| Compound Name | 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 57362942 |
| Molecular Formula | C10H8Br2O4 |
| Molecular Weight | 351.98 g/mol |
| Exact Mass | 349.88 |
| IUPAC Name | 3-(2,3-dibromo-4-hydroxy-5-methoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(C=CC(=O)O)c(Br)c(Br)c1O |
| InChI | InChI=1S/C10H8Br2O4/c1-16-6-4-5(2-3-7(13)14)8(11)9(12)10(6)15/h2-4,15H,1H3,(H,13,14) |
| InChIKey | ZJGHCJFPWLCJEX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.98 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|