C12H13BrO5 — CID 121010104
(E)-3-(2-bromo-3,4,5-trimethoxyphenyl)prop-2-enoic acid (PubChem CID 121010104) has the molecular formula C12H13BrO5 and a molecular weight of 317.14 g/mol. Its IUPAC name is (E)-3-(2-bromo-3,4,5-trimethoxyphenyl)prop-2-enoic acid.
| Compound Name | (E)-3-(2-bromo-3,4,5-trimethoxyphenyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 121010104 |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.14 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | (E)-3-(2-bromo-3,4,5-trimethoxyphenyl)prop-2-enoic acid |
| SMILES | COc1cc(/C=C/C(=O)O)c(Br)c(OC)c1OC |
| InChI | InChI=1S/C12H13BrO5/c1-16-8-6-7(4-5-9(14)15)10(13)12(18-3)11(8)17-2/h4-6H,1-3H3,(H,14,15)/b5-4+ |
| InChIKey | KVWPCSGGAVOLHJ-SNAWJCMRSA-N |
| XLogP | 2.57 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.14 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|