C11H11BrO5 — CID 22633147
(3-bromo-4-formyl-2,6-dimethoxyphenyl) acetate (PubChem CID 22633147) has the molecular formula C11H11BrO5 and a molecular weight of 303.11 g/mol. Its IUPAC name is (3-bromo-4-formyl-2,6-dimethoxyphenyl) acetate.
| Compound Name | (3-bromo-4-formyl-2,6-dimethoxyphenyl) acetate |
|---|---|
| PubChem CID | 22633147 |
| Molecular Formula | C11H11BrO5 |
| Molecular Weight | 303.11 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | (3-bromo-4-formyl-2,6-dimethoxyphenyl) acetate |
| SMILES | COc1cc(C=O)c(Br)c(OC)c1OC(C)=O |
| InChI | InChI=1S/C11H11BrO5/c1-6(14)17-10-8(15-2)4-7(5-13)9(12)11(10)16-3/h4-5H,1-3H3 |
| InChIKey | RJTRFDWVTSVMKO-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.11 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|