C12H15NO4 — CID 84798477
N-(5-formyl-2,3-dimethoxy-6-methylphenyl)acetamide (PubChem CID 84798477) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is N-(5-formyl-2,3-dimethoxy-6-methylphenyl)acetamide.
| Compound Name | N-(5-formyl-2,3-dimethoxy-6-methylphenyl)acetamide |
|---|---|
| PubChem CID | 84798477 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | N-(5-formyl-2,3-dimethoxy-6-methylphenyl)acetamide |
| SMILES | COc1cc(C=O)c(C)c(NC(C)=O)c1OC |
| InChI | InChI=1S/C12H15NO4/c1-7-9(6-14)5-10(16-3)12(17-4)11(7)13-8(2)15/h5-6H,1-4H3,(H,13,15) |
| InChIKey | MDDDYMXCWQPHOU-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|