C13H15NO4 — CID 18445847
N-(5,6-dimethoxy-1-oxo-2,3-dihydroinden-4-yl)acetamide (PubChem CID 18445847) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is N-(5,6-dimethoxy-1-oxo-2,3-dihydroinden-4-yl)acetamide.
| Compound Name | N-(5,6-dimethoxy-1-oxo-2,3-dihydroinden-4-yl)acetamide |
|---|---|
| PubChem CID | 18445847 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | N-(5,6-dimethoxy-1-oxo-2,3-dihydroinden-4-yl)acetamide |
| SMILES | COc1cc2c(c(NC(C)=O)c1OC)CCC2=O |
| InChI | InChI=1S/C13H15NO4/c1-7(15)14-12-8-4-5-10(16)9(8)6-11(17-2)13(12)18-3/h6H,4-5H2,1-3H3,(H,14,15) |
| InChIKey | CDDDTCJVJYYXHI-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |