C10H11F2NO3 — CID 150969889
N-(2,6-difluoro-3,5-dimethoxyphenyl)acetamide (PubChem CID 150969889) has the molecular formula C10H11F2NO3 and a molecular weight of 231.20 g/mol. Its IUPAC name is N-(2,6-difluoro-3,5-dimethoxyphenyl)acetamide.
| Compound Name | N-(2,6-difluoro-3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 150969889 |
| Molecular Formula | C10H11F2NO3 |
| Molecular Weight | 231.20 g/mol |
| Exact Mass | 231.07 |
| IUPAC Name | N-(2,6-difluoro-3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(F)c(NC(C)=O)c1F |
| InChI | InChI=1S/C10H11F2NO3/c1-5(14)13-10-8(11)6(15-2)4-7(16-3)9(10)12/h4H,1-3H3,(H,13,14) |
| InChIKey | LNWTWYISMUUYHO-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.20 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |