C18H20Cl4N2O5 — CID 159426451
2,6-dichloro-3,5-dimethoxyaniline;N-(2,6-dichloro-3,5-dimethoxyphenyl)acetamide (PubChem CID 159426451) has the molecular formula C18H20Cl4N2O5 and a molecular weight of 486.18 g/mol. Its IUPAC name is 2,6-dichloro-3,5-dimethoxyaniline;N-(2,6-dichloro-3,5-dimethoxyphenyl)acetamide.
| Compound Name | 2,6-dichloro-3,5-dimethoxyaniline;N-(2,6-dichloro-3,5-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 159426451 |
| Molecular Formula | C18H20Cl4N2O5 |
| Molecular Weight | 486.18 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | 2,6-dichloro-3,5-dimethoxyaniline;N-(2,6-dichloro-3,5-dimethoxyphenyl)acetamide |
| SMILES | COc1cc(OC)c(Cl)c(N)c1Cl.COc1cc(OC)c(Cl)c(NC(C)=O)c1Cl |
| InChI | InChI=1S/C10H11Cl2NO3.C8H9Cl2NO2/c1-5(14)13-10-8(11)6(15-2)4-7(16-3)9(10)12;1-12-4-3-5(13-2)7(10)8(11)6(4)9/h4H,1-3H3,(H,13,14);3H,11H2,1-2H3 |
| InChIKey | LQKLUPSSZVEITL-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.18 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|