C9H7Cl3O3 — CID 156633344
2,6-dichloro-3,5-dimethoxybenzoyl chloride (PubChem CID 156633344) has the molecular formula C9H7Cl3O3 and a molecular weight of 269.51 g/mol. Its IUPAC name is 2,6-dichloro-3,5-dimethoxybenzoyl chloride.
| Compound Name | 2,6-dichloro-3,5-dimethoxybenzoyl chloride |
|---|---|
| PubChem CID | 156633344 |
| Molecular Formula | C9H7Cl3O3 |
| Molecular Weight | 269.51 g/mol |
| Exact Mass | 267.95 |
| IUPAC Name | 2,6-dichloro-3,5-dimethoxybenzoyl chloride |
| SMILES | COc1cc(OC)c(Cl)c(C(=O)Cl)c1Cl |
| InChI | InChI=1S/C9H7Cl3O3/c1-14-4-3-5(15-2)8(11)6(7(4)10)9(12)13/h3H,1-2H3 |
| InChIKey | QQLSUVYNWGVHLO-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.51 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|