C8H5Cl3O2 — CID 21483940
3,4-dichloro-5-methoxybenzoyl chloride (PubChem CID 21483940) has the molecular formula C8H5Cl3O2 and a molecular weight of 239.48 g/mol. Its IUPAC name is 3,4-dichloro-5-methoxybenzoyl chloride.
| Compound Name | 3,4-dichloro-5-methoxybenzoyl chloride |
|---|---|
| PubChem CID | 21483940 |
| Molecular Formula | C8H5Cl3O2 |
| Molecular Weight | 239.48 g/mol |
| Exact Mass | 237.94 |
| IUPAC Name | 3,4-dichloro-5-methoxybenzoyl chloride |
| SMILES | COc1cc(C(=O)Cl)cc(Cl)c1Cl |
| InChI | InChI=1S/C8H5Cl3O2/c1-13-6-3-4(8(11)12)2-5(9)7(6)10/h2-3H,1H3 |
| InChIKey | FWNPCROQQMWXCA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.48 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|