C7H4Cl4O — CID 13649
1,2,3,4-tetrachloro-5-methoxybenzene (PubChem CID 13649) has the molecular formula C7H4Cl4O and a molecular weight of 245.92 g/mol. Its IUPAC name is 1,2,3,4-tetrachloro-5-methoxybenzene.
| Compound Name | 1,2,3,4-tetrachloro-5-methoxybenzene |
|---|---|
| PubChem CID | 13649 |
| Molecular Formula | C7H4Cl4O |
| Molecular Weight | 245.92 g/mol |
| Exact Mass | 243.90 |
| IUPAC Name | 1,2,3,4-tetrachloro-5-methoxybenzene |
| SMILES | COc1cc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7H4Cl4O/c1-12-4-2-3(8)5(9)7(11)6(4)10/h2H,1H3 |
| InChIKey | FUUHMSUPRUNWRQ-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.92 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|