C11H17ClO — CID 144758840
1-chloro-5-methoxy-2,4-dimethylbenzene;ethane (PubChem CID 144758840) has the molecular formula C11H17ClO and a molecular weight of 200.71 g/mol. Its IUPAC name is 1-chloro-5-methoxy-2,4-dimethylbenzene;ethane.
| Compound Name | 1-chloro-5-methoxy-2,4-dimethylbenzene;ethane |
|---|---|
| PubChem CID | 144758840 |
| Molecular Formula | C11H17ClO |
| Molecular Weight | 200.71 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 1-chloro-5-methoxy-2,4-dimethylbenzene;ethane |
| SMILES | CC.COc1cc(Cl)c(C)cc1C |
| InChI | InChI=1S/C9H11ClO.C2H6/c1-6-4-7(2)9(11-3)5-8(6)10;1-2/h4-5H,1-3H3;1-2H3 |
| InChIKey | GDYYCHFSPLHTTR-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.71 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |