C8H8Cl2 — CID 4174838
1,5-dichloro-2,4-dimethylbenzene (PubChem CID 4174838) has the molecular formula C8H8Cl2 and a molecular weight of 175.06 g/mol. Its IUPAC name is 1,5-dichloro-2,4-dimethylbenzene.
| Compound Name | 1,5-dichloro-2,4-dimethylbenzene |
|---|---|
| PubChem CID | 4174838 |
| Molecular Formula | C8H8Cl2 |
| Molecular Weight | 175.06 g/mol |
| Exact Mass | 174.00 |
| IUPAC Name | 1,5-dichloro-2,4-dimethylbenzene |
| SMILES | Cc1cc(C)c(Cl)cc1Cl |
| InChI | InChI=1S/C8H8Cl2/c1-5-3-6(2)8(10)4-7(5)9/h3-4H,1-2H3 |
| InChIKey | SFPXVPWDXSCTBK-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.06 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |