C9H10ClNO — CID 82551019
5-chloro-2,4-dimethylbenzamide (PubChem CID 82551019) has the molecular formula C9H10ClNO and a molecular weight of 183.64 g/mol. Its IUPAC name is 5-chloro-2,4-dimethylbenzamide.
| Compound Name | 5-chloro-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 82551019 |
| Molecular Formula | C9H10ClNO |
| Molecular Weight | 183.64 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 5-chloro-2,4-dimethylbenzamide |
| SMILES | Cc1cc(C)c(C(N)=O)cc1Cl |
| InChI | InChI=1S/C9H10ClNO/c1-5-3-6(2)8(10)4-7(5)9(11)12/h3-4H,1-2H3,(H2,11,12) |
| InChIKey | XJAWMXDMHURUBK-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.64 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |