5-chloro-2,4-dimethylbenzoyl chloride

C9H8Cl2O — CID 82633624

IUPAC5-chloro-2,4-dimethylbenzoyl chloride
SMILESCc1cc(C)c(C(=O)Cl)cc1Cl
InChIInChI=1S/C9H8Cl2O/c1-5-3-6(2)8(10)4-7(5)9(11)12/h3-4H,1-2H3
InChIKeyMJIVTHQBAIDVMZ-UHFFFAOYSA-N
MW203.07 g/mol
LogP3.34
Rot. Bonds1

About 5-chloro-2,4-dimethylbenzoyl chloride

5-chloro-2,4-dimethylbenzoyl chloride (PubChem CID 82633624) has the molecular formula C9H8Cl2O and a molecular weight of 203.07 g/mol. Its IUPAC name is 5-chloro-2,4-dimethylbenzoyl chloride.

Molecular Properties

Compound Name5-chloro-2,4-dimethylbenzoyl chloride
PubChem CID82633624
Molecular FormulaC9H8Cl2O
Molecular Weight203.07 g/mol
Exact Mass202.00
IUPAC Name5-chloro-2,4-dimethylbenzoyl chloride
SMILESCc1cc(C)c(C(=O)Cl)cc1Cl
InChIInChI=1S/C9H8Cl2O/c1-5-3-6(2)8(10)4-7(5)9(11)12/h3-4H,1-2H3
InChIKeyMJIVTHQBAIDVMZ-UHFFFAOYSA-N
XLogP3.34
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500203.07
LogP ≤ 53.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 5-chloro-2,4-dimethylbenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-chloro-2,4-dimethylbenzoyl chloride?
The IUPAC name of 5-chloro-2,4-dimethylbenzoyl chloride (CID 82633624) is 5-chloro-2,4-dimethylbenzoyl chloride.
What is the SMILES notation for 5-chloro-2,4-dimethylbenzoyl chloride?
The canonical SMILES for 5-chloro-2,4-dimethylbenzoyl chloride is Cc1cc(C)c(C(=O)Cl)cc1Cl.
What is the InChIKey of 5-chloro-2,4-dimethylbenzoyl chloride?
The InChIKey is MJIVTHQBAIDVMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8Cl2O/c1-5-3-6(2)8(10)4-7(5)9(11)12/h3-4H,1-2H3.
What are the key properties of 5-chloro-2,4-dimethylbenzoyl chloride?
5-chloro-2,4-dimethylbenzoyl chloride has a molecular weight of 203.07 g/mol, XLogP of 3.34, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2,4-dimethylbenzoyl chloride is sourced from PubChem (CID 82633624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).