C13H24ClN — CID 145268863
5-chloro-N,2,4-trimethylaniline;ethane (PubChem CID 145268863) has the molecular formula C13H24ClN and a molecular weight of 229.79 g/mol. Its IUPAC name is 5-chloro-N,2,4-trimethylaniline;ethane.
| Compound Name | 5-chloro-N,2,4-trimethylaniline;ethane |
|---|---|
| PubChem CID | 145268863 |
| Molecular Formula | C13H24ClN |
| Molecular Weight | 229.79 g/mol |
| Exact Mass | 229.16 |
| IUPAC Name | 5-chloro-N,2,4-trimethylaniline;ethane |
| SMILES | CC.CC.CNc1cc(Cl)c(C)cc1C |
| InChI | InChI=1S/C9H12ClN.2C2H6/c1-6-4-7(2)9(11-3)5-8(6)10;2*1-2/h4-5,11H,1-3H3;2*1-2H3 |
| InChIKey | AWYGAGLQCYHWFB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.79 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |