C9H9Cl2NO — CID 112703957
N-(2,5-dichloro-4-methylphenyl)acetamide (PubChem CID 112703957) has the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. Its IUPAC name is N-(2,5-dichloro-4-methylphenyl)acetamide.
| Compound Name | N-(2,5-dichloro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 112703957 |
| Molecular Formula | C9H9Cl2NO |
| Molecular Weight | 218.08 g/mol |
| Exact Mass | 217.01 |
| IUPAC Name | N-(2,5-dichloro-4-methylphenyl)acetamide |
| SMILES | CC(=O)Nc1cc(Cl)c(C)cc1Cl |
| InChI | InChI=1S/C9H9Cl2NO/c1-5-3-8(11)9(4-7(5)10)12-6(2)13/h3-4H,1-2H3,(H,12,13) |
| InChIKey | SAOCKHKVGKRFBY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.08 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |