C9H7Cl2NO3 — CID 104727934
2-(2,5-dichloro-4-methylanilino)-2-oxoacetic acid (PubChem CID 104727934) has the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. Its IUPAC name is 2-(2,5-dichloro-4-methylanilino)-2-oxoacetic acid.
| Compound Name | 2-(2,5-dichloro-4-methylanilino)-2-oxoacetic acid |
|---|---|
| PubChem CID | 104727934 |
| Molecular Formula | C9H7Cl2NO3 |
| Molecular Weight | 248.06 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 2-(2,5-dichloro-4-methylanilino)-2-oxoacetic acid |
| SMILES | Cc1cc(Cl)c(NC(=O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C9H7Cl2NO3/c1-4-2-6(11)7(3-5(4)10)12-8(13)9(14)15/h2-3H,1H3,(H,12,13)(H,14,15) |
| InChIKey | UYBBJPAWAPELOU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.06 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|