C12H13Cl2NO3 — CID 104727936
3-(2,5-dichloro-4-methylanilino)-2,2-dimethyl-3-oxopropanoic acid (PubChem CID 104727936) has the molecular formula C12H13Cl2NO3 and a molecular weight of 290.15 g/mol. Its IUPAC name is 3-(2,5-dichloro-4-methylanilino)-2,2-dimethyl-3-oxopropanoic acid.
| Compound Name | 3-(2,5-dichloro-4-methylanilino)-2,2-dimethyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 104727936 |
| Molecular Formula | C12H13Cl2NO3 |
| Molecular Weight | 290.15 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 3-(2,5-dichloro-4-methylanilino)-2,2-dimethyl-3-oxopropanoic acid |
| SMILES | Cc1cc(Cl)c(NC(=O)C(C)(C)C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H13Cl2NO3/c1-6-4-8(14)9(5-7(6)13)15-10(16)12(2,3)11(17)18/h4-5H,1-3H3,(H,15,16)(H,17,18) |
| InChIKey | RZGOFWYFNUUVHV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.15 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|