C16H20Cl2N2O — CID 104727193
2-cyano-N-(2,5-dichloro-4-methylphenyl)-2-propylpentanamide (PubChem CID 104727193) has the molecular formula C16H20Cl2N2O and a molecular weight of 327.26 g/mol. Its IUPAC name is 2-cyano-N-(2,5-dichloro-4-methylphenyl)-2-propylpentanamide.
| Compound Name | 2-cyano-N-(2,5-dichloro-4-methylphenyl)-2-propylpentanamide |
|---|---|
| PubChem CID | 104727193 |
| Molecular Formula | C16H20Cl2N2O |
| Molecular Weight | 327.26 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-cyano-N-(2,5-dichloro-4-methylphenyl)-2-propylpentanamide |
| SMILES | CCCC(C#N)(CCC)C(=O)Nc1cc(Cl)c(C)cc1Cl |
| InChI | InChI=1S/C16H20Cl2N2O/c1-4-6-16(10-19,7-5-2)15(21)20-14-9-12(17)11(3)8-13(14)18/h8-9H,4-7H2,1-3H3,(H,20,21) |
| InChIKey | JRDLCAVWDMDMKM-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.26 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |