C12H12Cl2N2O5 — CID 104727737
(2R)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]butanedioic acid (PubChem CID 104727737) has the molecular formula C12H12Cl2N2O5 and a molecular weight of 335.14 g/mol. Its IUPAC name is (2R)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]butanedioic acid.
| Compound Name | (2R)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]butanedioic acid |
|---|---|
| PubChem CID | 104727737 |
| Molecular Formula | C12H12Cl2N2O5 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | (2R)-2-[(2,5-dichloro-4-methylphenyl)carbamoylamino]butanedioic acid |
| SMILES | Cc1cc(Cl)c(NC(=O)N[C@H](CC(=O)O)C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N2O5/c1-5-2-7(14)8(3-6(5)13)15-12(21)16-9(11(19)20)4-10(17)18/h2-3,9H,4H2,1H3,(H,17,18)(H,19,20)(H2,15,16,21)/t9-/m1/s1 |
| InChIKey | SEWMQDYDIMSTQC-SECBINFHSA-N |
| XLogP | 2.35 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |