C12H14BrClN2O4 — CID 107828915
(2R)-2-[(2-bromo-5-chloro-4-methylphenyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107828915) has the molecular formula C12H14BrClN2O4 and a molecular weight of 365.61 g/mol. Its IUPAC name is (2R)-2-[(2-bromo-5-chloro-4-methylphenyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[(2-bromo-5-chloro-4-methylphenyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107828915 |
| Molecular Formula | C12H14BrClN2O4 |
| Molecular Weight | 365.61 g/mol |
| Exact Mass | 363.98 |
| IUPAC Name | (2R)-2-[(2-bromo-5-chloro-4-methylphenyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | Cc1cc(Br)c(NC(=O)N[C@H](CCO)C(=O)O)cc1Cl |
| InChI | InChI=1S/C12H14BrClN2O4/c1-6-4-7(13)10(5-8(6)14)16-12(20)15-9(2-3-17)11(18)19/h4-5,9,17H,2-3H2,1H3,(H,18,19)(H2,15,16,20)/t9-/m1/s1 |
| InChIKey | YITDWNREUYXCPO-SECBINFHSA-N |
| XLogP | 2.37 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.61 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |