C11H12BrClN2O4 — CID 107828516
(2R)-2-[(2-bromo-5-chlorophenyl)carbamoylamino]-4-hydroxybutanoic acid (PubChem CID 107828516) has the molecular formula C11H12BrClN2O4 and a molecular weight of 351.58 g/mol. Its IUPAC name is (2R)-2-[(2-bromo-5-chlorophenyl)carbamoylamino]-4-hydroxybutanoic acid.
| Compound Name | (2R)-2-[(2-bromo-5-chlorophenyl)carbamoylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 107828516 |
| Molecular Formula | C11H12BrClN2O4 |
| Molecular Weight | 351.58 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | (2R)-2-[(2-bromo-5-chlorophenyl)carbamoylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(Nc1cc(Cl)ccc1Br)N[C@H](CCO)C(=O)O |
| InChI | InChI=1S/C11H12BrClN2O4/c12-7-2-1-6(13)5-9(7)15-11(19)14-8(3-4-16)10(17)18/h1-2,5,8,16H,3-4H2,(H,17,18)(H2,14,15,19)/t8-/m1/s1 |
| InChIKey | AKECCIZWHUAPKP-MRVPVSSYSA-N |
| XLogP | 2.06 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.58 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |