C12H14Cl2N2O3 — CID 107564807
(2S)-2-[(2,5-dichlorophenyl)carbamoylamino]pentanoic acid (PubChem CID 107564807) has the molecular formula C12H14Cl2N2O3 and a molecular weight of 305.16 g/mol. Its IUPAC name is (2S)-2-[(2,5-dichlorophenyl)carbamoylamino]pentanoic acid.
| Compound Name | (2S)-2-[(2,5-dichlorophenyl)carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 107564807 |
| Molecular Formula | C12H14Cl2N2O3 |
| Molecular Weight | 305.16 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | (2S)-2-[(2,5-dichlorophenyl)carbamoylamino]pentanoic acid |
| SMILES | CCC[C@H](NC(=O)Nc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C12H14Cl2N2O3/c1-2-3-9(11(17)18)15-12(19)16-10-6-7(13)4-5-8(10)14/h4-6,9H,2-3H2,1H3,(H,17,18)(H2,15,16,19)/t9-/m0/s1 |
| InChIKey | YVLCSGGQTCKMLC-VIFPVBQESA-N |
| XLogP | 3.37 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.16 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |