C13H16Cl2N2O3 — CID 43555003
2-[(2,5-dichlorophenyl)carbamoylamino]hexanoic acid (PubChem CID 43555003) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 2-[(2,5-dichlorophenyl)carbamoylamino]hexanoic acid.
| Compound Name | 2-[(2,5-dichlorophenyl)carbamoylamino]hexanoic acid |
|---|---|
| PubChem CID | 43555003 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | 2-[(2,5-dichlorophenyl)carbamoylamino]hexanoic acid |
| SMILES | CCCCC(NC(=O)Nc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C13H16Cl2N2O3/c1-2-3-4-10(12(18)19)16-13(20)17-11-7-8(14)5-6-9(11)15/h5-7,10H,2-4H2,1H3,(H,18,19)(H2,16,17,20) |
| InChIKey | AYFGXMFPFFQMOM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |