C14H17Cl2NO3S — CID 107144440
(2S)-2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]hexanoic acid (PubChem CID 107144440) has the molecular formula C14H17Cl2NO3S and a molecular weight of 350.27 g/mol. Its IUPAC name is (2S)-2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]hexanoic acid.
| Compound Name | (2S)-2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 107144440 |
| Molecular Formula | C14H17Cl2NO3S |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | (2S)-2-[[2-(2,5-dichlorophenyl)sulfanylacetyl]amino]hexanoic acid |
| SMILES | CCCC[C@H](NC(=O)CSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H17Cl2NO3S/c1-2-3-4-11(14(19)20)17-13(18)8-21-12-7-9(15)5-6-10(12)16/h5-7,11H,2-4,8H2,1H3,(H,17,18)(H,19,20)/t11-/m0/s1 |
| InChIKey | JFMYIHCHLLEVRX-NSHDSACASA-N |
| XLogP | 3.85 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |