C11H11Cl2NO3S — CID 64583085
2-acetamido-3-(2,5-dichlorophenyl)sulfanylpropanoic acid (PubChem CID 64583085) has the molecular formula C11H11Cl2NO3S and a molecular weight of 308.19 g/mol. Its IUPAC name is 2-acetamido-3-(2,5-dichlorophenyl)sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-(2,5-dichlorophenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 64583085 |
| Molecular Formula | C11H11Cl2NO3S |
| Molecular Weight | 308.19 g/mol |
| Exact Mass | 306.98 |
| IUPAC Name | 2-acetamido-3-(2,5-dichlorophenyl)sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSc1cc(Cl)ccc1Cl)C(=O)O |
| InChI | InChI=1S/C11H11Cl2NO3S/c1-6(15)14-9(11(16)17)5-18-10-4-7(12)2-3-8(10)13/h2-4,9H,5H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | VFQDEECXYWPVJF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.19 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |