C12H11ClN2O3S — CID 107768563
2-acetamido-3-(4-chloro-2-cyanophenyl)sulfanylpropanoic acid (PubChem CID 107768563) has the molecular formula C12H11ClN2O3S and a molecular weight of 298.75 g/mol. Its IUPAC name is 2-acetamido-3-(4-chloro-2-cyanophenyl)sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-(4-chloro-2-cyanophenyl)sulfanylpropanoic acid |
|---|---|
| PubChem CID | 107768563 |
| Molecular Formula | C12H11ClN2O3S |
| Molecular Weight | 298.75 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-acetamido-3-(4-chloro-2-cyanophenyl)sulfanylpropanoic acid |
| SMILES | CC(=O)NC(CSc1ccc(Cl)cc1C#N)C(=O)O |
| InChI | InChI=1S/C12H11ClN2O3S/c1-7(16)15-10(12(17)18)6-19-11-3-2-9(13)4-8(11)5-14/h2-4,10H,6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | ALYRJLLUYUBHBI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.75 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |