C11H12Cl2N2O5S — CID 163123903
2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4-dichloro-N-hydroxybenzeneamine oxide (PubChem CID 163123903) has the molecular formula C11H12Cl2N2O5S and a molecular weight of 355.20 g/mol. Its IUPAC name is 2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4-dichloro-N-hydroxybenzeneamine oxide.
| Compound Name | 2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4-dichloro-N-hydroxybenzeneamine oxide |
|---|---|
| PubChem CID | 163123903 |
| Molecular Formula | C11H12Cl2N2O5S |
| Molecular Weight | 355.20 g/mol |
| Exact Mass | 353.98 |
| IUPAC Name | 2-[(2R)-2-acetamido-2-carboxyethyl]sulfanyl-3,4-dichloro-N-hydroxybenzeneamine oxide |
| SMILES | CC(=O)N[C@@H](CSc1c([NH+]([O-])O)ccc(Cl)c1Cl)C(=O)O |
| InChI | InChI=1S/C11H12Cl2N2O5S/c1-5(16)14-7(11(17)18)4-21-10-8(15(19)20)3-2-6(12)9(10)13/h2-3,7,15,19H,4H2,1H3,(H,14,16)(H,17,18)/t7-/m0/s1 |
| InChIKey | CNFSDBSABJGVAT-ZETCQYMHSA-N |
| XLogP | 1.08 |
| TPSA | 114.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.20 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|