C13H16N2O5S — CID 166642233
(2R)-2-acetamido-3-[2-hydroxy-5-[(2,2,2-trideuterioacetyl)amino]phenyl]sulfanylpropanoic acid (PubChem CID 166642233) has the molecular formula C13H16N2O5S and a molecular weight of 315.37 g/mol. Its IUPAC name is (2R)-2-acetamido-3-[2-hydroxy-5-[(2,2,2-trideuterioacetyl)amino]phenyl]sulfanylpropanoic acid.
| Compound Name | (2R)-2-acetamido-3-[2-hydroxy-5-[(2,2,2-trideuterioacetyl)amino]phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 166642233 |
| Molecular Formula | C13H16N2O5S |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | (2R)-2-acetamido-3-[2-hydroxy-5-[(2,2,2-trideuterioacetyl)amino]phenyl]sulfanylpropanoic acid |
| SMILES | [2H]C([2H])([2H])C(=O)Nc1ccc(O)c(SC[C@H](NC(C)=O)C(=O)O)c1 |
| InChI | InChI=1S/C13H16N2O5S/c1-7(16)14-9-3-4-11(18)12(5-9)21-6-10(13(19)20)15-8(2)17/h3-5,10,18H,6H2,1-2H3,(H,14,16)(H,15,17)(H,19,20)/t10-/m0/s1/i1D3 |
| InChIKey | DVPRQNKJGQEICH-ASGODXDTSA-N |
| XLogP | 1.03 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|