C17H24N2O7S — CID 101350829
2-acetamido-3-[3-ethoxy-2-hydroxy-5-(propan-2-yloxycarbonylamino)phenyl]sulfanylpropanoic acid (PubChem CID 101350829) has the molecular formula C17H24N2O7S and a molecular weight of 400.45 g/mol. Its IUPAC name is 2-acetamido-3-[3-ethoxy-2-hydroxy-5-(propan-2-yloxycarbonylamino)phenyl]sulfanylpropanoic acid.
| Compound Name | 2-acetamido-3-[3-ethoxy-2-hydroxy-5-(propan-2-yloxycarbonylamino)phenyl]sulfanylpropanoic acid |
|---|---|
| PubChem CID | 101350829 |
| Molecular Formula | C17H24N2O7S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | 2-acetamido-3-[3-ethoxy-2-hydroxy-5-(propan-2-yloxycarbonylamino)phenyl]sulfanylpropanoic acid |
| SMILES | CCOc1cc(NC(=O)OC(C)C)cc(SCC(NC(C)=O)C(=O)O)c1O |
| InChI | InChI=1S/C17H24N2O7S/c1-5-25-13-6-11(19-17(24)26-9(2)3)7-14(15(13)21)27-8-12(16(22)23)18-10(4)20/h6-7,9,12,21H,5,8H2,1-4H3,(H,18,20)(H,19,24)(H,22,23) |
| InChIKey | IADYDWIVRNJPPZ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|