C15H21NO3 — CID 13259854
propan-2-yl N-(4-ethoxy-3-prop-2-enylphenyl)carbamate (PubChem CID 13259854) has the molecular formula C15H21NO3 and a molecular weight of 263.34 g/mol. Its IUPAC name is propan-2-yl N-(4-ethoxy-3-prop-2-enylphenyl)carbamate.
| Compound Name | propan-2-yl N-(4-ethoxy-3-prop-2-enylphenyl)carbamate |
|---|---|
| PubChem CID | 13259854 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | propan-2-yl N-(4-ethoxy-3-prop-2-enylphenyl)carbamate |
| SMILES | C=CCc1cc(NC(=O)OC(C)C)ccc1OCC |
| InChI | InChI=1S/C15H21NO3/c1-5-7-12-10-13(8-9-14(12)18-6-2)16-15(17)19-11(3)4/h5,8-11H,1,6-7H2,2-4H3,(H,16,17) |
| InChIKey | LFWYKUXDDXOIRL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|